Products 1370238-26-8
CAS 1370238-26-8 is the registry number for Cap-dependent endonuclease-IN-26. Offered by: MedChemExpress. Available pack sizes: Get quote.
1-benzhydryl-5-hydroxy-3-propan-2-yl-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione (CAS 1370238-26-8) is a chemical compound with the molecular formula C23H23N3O3 and a molecular weight of 389.4 g/mol. IUPAC name: 1-benzhydryl-5-hydroxy-3-propan-2-yl-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione. InChIKey: XBUAYFHRCVFRFT-UHFFFAOYSA-N.
| Molecular formula | C23H23N3O3 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | 1-benzhydryl-5-hydroxy-3-propan-2-yl-2H-pyrido[2,1-f][1,2,4]triazine-4,6-dione |
| InChIKey | XBUAYFHRCVFRFT-UHFFFAOYSA-N |
| SMILES | CC(C)N1CN(N2C=CC(=O)C(=C2C1=O)O)C(C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)
Synonyms:
Cap-dependent endonuclease-IN-26, orb1688281