Products 123441-05-4

CAS 123441-05-4 is the registry number for Rivastigmine Impurity 19. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

[4-[1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate (CAS 123441-05-4) is a chemical compound with the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. IUPAC name: [4-[1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate. InChIKey: ICZPPQRPJSMXFM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H22N2O2
Molecular weight250.34 g/mol
IUPAC name[4-[1-(dimethylamino)ethyl]phenyl] N-ethyl-N-methylcarbamate
InChIKeyICZPPQRPJSMXFM-UHFFFAOYSA-N
SMILESCCN(C)C(=O)OC1=CC=C(C=C1)C(C)N(C)C

Computed by PubChem (NCBI)