CAS 1234616-73-9 is the registry number for 4-Chloro-1,8-naphthyridine-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 100mg.
4-chloro-1,8-naphthyridine-3-carbonitrile (CAS 1234616-73-9) is a chemical compound with the molecular formula C9H4ClN3 and a molecular weight of 189.60 g/mol. IUPAC name: 4-chloro-1,8-naphthyridine-3-carbonitrile. InChIKey: UIEOYAUPKYAWEB-UHFFFAOYSA-N.
| Molecular formula | C9H4ClN3 |
|---|---|
| Molecular weight | 189.60 g/mol |
| IUPAC name | 4-chloro-1,8-naphthyridine-3-carbonitrile |
| InChIKey | UIEOYAUPKYAWEB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN=C2N=C1)C#N)Cl |
Computed by PubChem (NCBI)