CAS 1231761-46-8 is the registry number for 5-Chloroquinoxaline-2-carbonitrile, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloroquinoxaline-2-carbonitrile (CAS 1231761-46-8) is a chemical compound with the molecular formula C9H4ClN3 and a molecular weight of 189.60 g/mol. IUPAC name: 5-chloroquinoxaline-2-carbonitrile. InChIKey: RUOYSTREMBFISE-UHFFFAOYSA-N.
| Molecular formula | C9H4ClN3 |
|---|---|
| Molecular weight | 189.60 g/mol |
| IUPAC name | 5-chloroquinoxaline-2-carbonitrile |
| InChIKey | RUOYSTREMBFISE-UHFFFAOYSA-N |
| SMILES | C1=CC2=NC(=CN=C2C(=C1)Cl)C#N |
Computed by PubChem (NCBI)