CAS 1231761-54-8 appears in our catalog under these names: 4-Chloroquinazoline-8-carbonitrile, 95%, 4-Chloroquinazoline-8-carbonitrile, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-chloroquinazoline-8-carbonitrile (CAS 1231761-54-8) is a chemical compound with the molecular formula C9H4ClN3 and a molecular weight of 189.60 g/mol. IUPAC name: 4-chloroquinazoline-8-carbonitrile. InChIKey: BWXPTILLWVZEMH-UHFFFAOYSA-N.
| Molecular formula | C9H4ClN3 |
|---|---|
| Molecular weight | 189.60 g/mol |
| IUPAC name | 4-chloroquinazoline-8-carbonitrile |
| InChIKey | BWXPTILLWVZEMH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C2C(=C1)C(=NC=N2)Cl)C#N |
Computed by PubChem (NCBI)