CAS 1234710-00-9 appears in our catalog under these names: 2-(3-Azetidinyl)-1h-benzimidazole, 95%, 2-(Azetidin-3-yl)-1H-1,3-benzodiazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 100mg.
2-(azetidin-3-yl)-1H-benzimidazole (CAS 1234710-00-9) is a chemical compound with the molecular formula C10H11N3 and a molecular weight of 173.21 g/mol. IUPAC name: 2-(azetidin-3-yl)-1H-benzimidazole. InChIKey: UEPRLXODFILGGR-UHFFFAOYSA-N.
| Molecular formula | C10H11N3 |
|---|---|
| Molecular weight | 173.21 g/mol |
| IUPAC name | 2-(azetidin-3-yl)-1H-benzimidazole |
| InChIKey | UEPRLXODFILGGR-UHFFFAOYSA-N |
| SMILES | C1C(CN1)C2=NC3=CC=CC=C3N2 |
Computed by PubChem (NCBI)