CAS 1234875-52-5 appears in our catalog under these names: L-N-Boc-6-chlorotryptophan, 97%, L–N–Boc–6–chlorotryptophan, Boc-Trp(6-Cl)-OH 95%, L-N-Boc-6-chlorotryptophan, 95%, 95%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg.
(2S)-3-(6-chloro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1234875-52-5) is a chemical compound with the molecular formula C16H19ClN2O4 and a molecular weight of 338.78 g/mol. IUPAC name: (2S)-3-(6-chloro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: QIUZGOVYNVWFFN-ZDUSSCGKSA-N.
| Molecular formula | C16H19ClN2O4 |
|---|---|
| Molecular weight | 338.78 g/mol |
| IUPAC name | (2S)-3-(6-chloro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | QIUZGOVYNVWFFN-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CNC2=C1C=CC(=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)