Products 1313033-19-0
CAS 1313033-19-0 is the registry number for Boc-4-Chloro-DL-tryptophan, 95%. Offered by: AmBeed. Available pack sizes: 1g, 100mg.
3-(4-chloro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 1313033-19-0) is a chemical compound with the molecular formula C16H19ClN2O4 and a molecular weight of 338.78 g/mol. IUPAC name: 3-(4-chloro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: CXDHWYUFASUIHW-UHFFFAOYSA-N.
| Molecular formula | C16H19ClN2O4 |
|---|---|
| Molecular weight | 338.78 g/mol |
| IUPAC name | 3-(4-chloro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | CXDHWYUFASUIHW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC1=CNC2=C1C(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)