Products 1235-07-0
CAS 1235-07-0 is the registry number for Phenyramidol Salicylate. Offered by: Mikromol, LoGiCal. Available pack sizes: 50mg, 10mg.
2-hydroxybenzoic acid;1-phenyl-2-(pyridin-2-ylamino)ethanol (CAS 1235-07-0) is a chemical compound with the molecular formula C20H20N2O4 and a molecular weight of 352.4 g/mol. IUPAC name: 2-hydroxybenzoic acid;1-phenyl-2-(pyridin-2-ylamino)ethanol. InChIKey: HICVRAOITHDABM-UHFFFAOYSA-N.
| Molecular formula | C20H20N2O4 |
|---|---|
| Molecular weight | 352.4 g/mol |
| IUPAC name | 2-hydroxybenzoic acid;1-phenyl-2-(pyridin-2-ylamino)ethanol |
| InChIKey | HICVRAOITHDABM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(CNC2=CC=CC=N2)O.C1=CC=C(C(=C1)C(=O)O)O |
Computed by PubChem (NCBI)