CAS 123536-14-1 appears in our catalog under these names: Palonosetron Impurity 9, (R)-(+)-3-Aminoquinuclidine Dihydrochloride, (3R)-Aminoquinuclidine Dihydrochloride, >95% (HPLC), (R)–(+)–3–Aminoquinuclidine Dihydrochloride, (R)-(+)-3-Aminoquinuclidine Dihydrochloride, >98.0%(N)(T). Offered by: Chemat Brand, TRC, GLPBio, Biosynth, TCI. Available pack sizes: on request, 1g, 25g, 5g, 2g, 10g, 250mg, 100g.
(3R)-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride (CAS 123536-14-1) is a chemical compound with the molecular formula C7H16Cl2N2 and a molecular weight of 199.12 g/mol. IUPAC name: (3R)-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride. InChIKey: STZHBULOYDCZET-KLXURFKVSA-N.
| Molecular formula | C7H16Cl2N2 |
|---|---|
| Molecular weight | 199.12 g/mol |
| IUPAC name | (3R)-1-azabicyclo[2.2.2]octan-3-amine;dihydrochloride |
| InChIKey | STZHBULOYDCZET-KLXURFKVSA-N |
| SMILES | C1CN2CCC1[C@H](C2)N.Cl.Cl |
Computed by PubChem (NCBI)