CAS 1235407-33-6 appears in our catalog under these names: 1H-PYRAZOLE, 4-BROMO-3-NITRO-1-(TETRAHYDRO-2H-PYRAN-2-YL)-, 97%, 97%, 1H-Pyrazole, 4-bromo-3-nitro-1-(tetrahydro-2H-pyran-2-yl)-, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 500mg.
4-bromo-3-nitro-1-(oxan-2-yl)pyrazole (CAS 1235407-33-6) is a chemical compound with the molecular formula C8H10BrN3O3 and a molecular weight of 276.09 g/mol. IUPAC name: 4-bromo-3-nitro-1-(oxan-2-yl)pyrazole. InChIKey: JDGFYLDHUHASJC-UHFFFAOYSA-N.
| Molecular formula | C8H10BrN3O3 |
|---|---|
| Molecular weight | 276.09 g/mol |
| IUPAC name | 4-bromo-3-nitro-1-(oxan-2-yl)pyrazole |
| InChIKey | JDGFYLDHUHASJC-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C=C(C(=N2)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)