CAS 1235407-34-7 is the registry number for 4–Bromo–5–nitro–1–(tetrahydro–2H–pyran–2–yl)–1H–pyrazole. Offered by: GLPBio. Available pack sizes: 100mg.
4-bromo-5-nitro-1-(oxan-2-yl)pyrazole (CAS 1235407-34-7) is a chemical compound with the molecular formula C8H10BrN3O3 and a molecular weight of 276.09 g/mol. IUPAC name: 4-bromo-5-nitro-1-(oxan-2-yl)pyrazole. InChIKey: COVBZTWKVYCQBL-UHFFFAOYSA-N.
| Molecular formula | C8H10BrN3O3 |
|---|---|
| Molecular weight | 276.09 g/mol |
| IUPAC name | 4-bromo-5-nitro-1-(oxan-2-yl)pyrazole |
| InChIKey | COVBZTWKVYCQBL-UHFFFAOYSA-N |
| SMILES | C1CCOC(C1)N2C(=C(C=N2)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)