CAS 1235439-38-9 appears in our catalog under these names: N-(2-Aminoethyl)-2,4-difluorobenzamide hydrochloride, 95%, N-(2-Aminoethyl)-2,4-difluorobenzamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
N-(2-aminoethyl)-2,4-difluorobenzamide;hydrochloride (CAS 1235439-38-9) is a chemical compound with the molecular formula C9H11ClF2N2O and a molecular weight of 236.64 g/mol. IUPAC name: N-(2-aminoethyl)-2,4-difluorobenzamide;hydrochloride. InChIKey: JGAWDFDALAVXMA-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF2N2O |
|---|---|
| Molecular weight | 236.64 g/mol |
| IUPAC name | N-(2-aminoethyl)-2,4-difluorobenzamide;hydrochloride |
| InChIKey | JGAWDFDALAVXMA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)F)C(=O)NCCN.Cl |
Computed by PubChem (NCBI)