CAS 1251922-59-4 appears in our catalog under these names: N-(3,5-Difluorophenyl)-2-(methylamino)acetamide hydrochloride, 95%, N-(3,5-Difluorophenyl)-2-(methylamino)acetamide hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 250mg, 2,5g.
N-(3,5-difluorophenyl)-2-(methylamino)acetamide;hydrochloride (CAS 1251922-59-4) is a chemical compound with the molecular formula C9H11ClF2N2O and a molecular weight of 236.64 g/mol. IUPAC name: N-(3,5-difluorophenyl)-2-(methylamino)acetamide;hydrochloride. InChIKey: WZCITUBVMIIFIF-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF2N2O |
|---|---|
| Molecular weight | 236.64 g/mol |
| IUPAC name | N-(3,5-difluorophenyl)-2-(methylamino)acetamide;hydrochloride |
| InChIKey | WZCITUBVMIIFIF-UHFFFAOYSA-N |
| SMILES | CNCC(=O)NC1=CC(=CC(=C1)F)F.Cl |
Computed by PubChem (NCBI)