CAS 1235440-19-3 is the registry number for 3-(Chloromethyl)-1-(3-fluorophenyl)-1H-pyrazole. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
3-(chloromethyl)-1-(3-fluorophenyl)pyrazole (CAS 1235440-19-3) is a chemical compound with the molecular formula C10H8ClFN2 and a molecular weight of 210.63 g/mol. IUPAC name: 3-(chloromethyl)-1-(3-fluorophenyl)pyrazole. InChIKey: ZUZKLQHXSMUHGP-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFN2 |
|---|---|
| Molecular weight | 210.63 g/mol |
| IUPAC name | 3-(chloromethyl)-1-(3-fluorophenyl)pyrazole |
| InChIKey | ZUZKLQHXSMUHGP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)N2C=CC(=N2)CCl |
Computed by PubChem (NCBI)