Products 35715-72-1
CAS 35715-72-1 is the registry number for 4-(Chloromethyl)-1-(2-fluorophenyl)-1h-pyrazole, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
4-(chloromethyl)-1-(2-fluorophenyl)pyrazole (CAS 35715-72-1) is a chemical compound with the molecular formula C10H8ClFN2 and a molecular weight of 210.63 g/mol. IUPAC name: 4-(chloromethyl)-1-(2-fluorophenyl)pyrazole. InChIKey: NMVYSAQBXOWKGS-UHFFFAOYSA-N.
| Molecular formula | C10H8ClFN2 |
|---|---|
| Molecular weight | 210.63 g/mol |
| IUPAC name | 4-(chloromethyl)-1-(2-fluorophenyl)pyrazole |
| InChIKey | NMVYSAQBXOWKGS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=C(C=N2)CCl)F |
Computed by PubChem (NCBI)