CAS 1235440-23-9 appears in our catalog under these names: 2-Chloro-N-{3-((pyridin-2-ylsulfanyl)methyl)phenyl}acetamide, 95%, 2-Chloro-N-{3-((pyridin-2-ylsulfanyl)methyl)phenyl}acetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-chloro-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]acetamide (CAS 1235440-23-9) is a chemical compound with the molecular formula C14H13ClN2OS and a molecular weight of 292.8 g/mol. IUPAC name: 2-chloro-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]acetamide. InChIKey: OYHVKCOATSONJM-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2OS |
|---|---|
| Molecular weight | 292.8 g/mol |
| IUPAC name | 2-chloro-N-[3-(pyridin-2-ylsulfanylmethyl)phenyl]acetamide |
| InChIKey | OYHVKCOATSONJM-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)SCC2=CC(=CC=C2)NC(=O)CCl |
Computed by PubChem (NCBI)