CAS 377769-32-9 appears in our catalog under these names: 4-(4-Chloro-phenylsulfanylmethyl)-benzoic acid hydrazide, 95%, 4-{((4-chlorophenyl)sulfanyl)methyl}benzohydrazide, 95%, 4-{((4-Chlorophenyl)sulfanyl)methyl}benzohydrazide. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
4-[(4-chlorophenyl)sulfanylmethyl]benzohydrazide (CAS 377769-32-9) is a chemical compound with the molecular formula C14H13ClN2OS and a molecular weight of 292.8 g/mol. IUPAC name: 4-[(4-chlorophenyl)sulfanylmethyl]benzohydrazide. InChIKey: BKTLQTRTTMVFON-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN2OS |
|---|---|
| Molecular weight | 292.8 g/mol |
| IUPAC name | 4-[(4-chlorophenyl)sulfanylmethyl]benzohydrazide |
| InChIKey | BKTLQTRTTMVFON-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CSC2=CC=C(C=C2)Cl)C(=O)NN |
Computed by PubChem (NCBI)