CAS 1235441-16-3 appears in our catalog under these names: 2H-Chromene-3-sulfonyl chloride, 2H-Chromene-3-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.
2H-chromene-3-sulfonyl chloride (CAS 1235441-16-3) is a chemical compound with the molecular formula C9H7ClO3S and a molecular weight of 230.67 g/mol. IUPAC name: 2H-chromene-3-sulfonyl chloride. InChIKey: XGCKSIZJWKXGMW-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3S |
|---|---|
| Molecular weight | 230.67 g/mol |
| IUPAC name | 2H-chromene-3-sulfonyl chloride |
| InChIKey | XGCKSIZJWKXGMW-UHFFFAOYSA-N |
| SMILES | C1C(=CC2=CC=CC=C2O1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)