CAS 1935247-73-6 appears in our catalog under these names: 1-Oxo-2,3-dihydro-1H-indene-4-sulfonyl chloride, 95%, 1-Oxo-2,3-dihydro-1H-indene-4-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-oxo-2,3-dihydroindene-4-sulfonyl chloride (CAS 1935247-73-6) is a chemical compound with the molecular formula C9H7ClO3S and a molecular weight of 230.67 g/mol. IUPAC name: 1-oxo-2,3-dihydroindene-4-sulfonyl chloride. InChIKey: BLWPETYKWUHVLZ-UHFFFAOYSA-N.
| Molecular formula | C9H7ClO3S |
|---|---|
| Molecular weight | 230.67 g/mol |
| IUPAC name | 1-oxo-2,3-dihydroindene-4-sulfonyl chloride |
| InChIKey | BLWPETYKWUHVLZ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)C2=C1C(=CC=C2)S(=O)(=O)Cl |
Computed by PubChem (NCBI)