CAS 1235441-20-9 appears in our catalog under these names: 1-(3-Fluorophenyl)-5-(trifluoromethyl)-1H-1,2,3-triazole-4-carboxylic acid, 97%, 1-(3-Fluorophenyl)-5-(trifluoromethyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-(3-fluorophenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid (CAS 1235441-20-9) is a chemical compound with the molecular formula C10H5F4N3O2 and a molecular weight of 275.16 g/mol. IUPAC name: 1-(3-fluorophenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid. InChIKey: NOQOHHSLFIWMSY-UHFFFAOYSA-N.
| Molecular formula | C10H5F4N3O2 |
|---|---|
| Molecular weight | 275.16 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
| InChIKey | NOQOHHSLFIWMSY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)N2C(=C(N=N2)C(=O)O)C(F)(F)F |
Computed by PubChem (NCBI)