CAS 1240529-31-0 is the registry number for 1-(2-Fluorophenyl)-5-(trifluoromethyl)-1H-1,2,3-triazole-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1-(2-fluorophenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid (CAS 1240529-31-0) is a chemical compound with the molecular formula C10H5F4N3O2 and a molecular weight of 275.16 g/mol. IUPAC name: 1-(2-fluorophenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid. InChIKey: RVQMJWLWOIXXHW-UHFFFAOYSA-N.
| Molecular formula | C10H5F4N3O2 |
|---|---|
| Molecular weight | 275.16 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
| InChIKey | RVQMJWLWOIXXHW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=C(N=N2)C(=O)O)C(F)(F)F)F |
Computed by PubChem (NCBI)