CAS 1235441-72-1 is the registry number for 4-(1H-1,3-Benzodiazol-1-yl)benzene-1-carboximidamide hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(benzimidazol-1-yl)benzenecarboximidamide;hydrochloride (CAS 1235441-72-1) is a chemical compound with the molecular formula C14H13ClN4 and a molecular weight of 272.73 g/mol. IUPAC name: 4-(benzimidazol-1-yl)benzenecarboximidamide;hydrochloride. InChIKey: MKZWCFNEAAAFAB-UHFFFAOYSA-N.
| Molecular formula | C14H13ClN4 |
|---|---|
| Molecular weight | 272.73 g/mol |
| IUPAC name | 4-(benzimidazol-1-yl)benzenecarboximidamide;hydrochloride |
| InChIKey | MKZWCFNEAAAFAB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=CN2C3=CC=C(C=C3)C(=N)N.Cl |
Computed by PubChem (NCBI)