CAS 123606-62-2 is the registry number for 5'-O-Benzoyl-2'-deoxyuridine. Offered by: Biosynth. Available pack sizes: 2g, 1g, 5g, 10g.
[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl benzoate (CAS 123606-62-2) is a chemical compound with the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. IUPAC name: [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl benzoate. InChIKey: YZQWECMAHIKEMU-OUCADQQQSA-N.
| Molecular formula | C16H16N2O6 |
|---|---|
| Molecular weight | 332.31 g/mol |
| IUPAC name | [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-3-hydroxyoxolan-2-yl]methyl benzoate |
| InChIKey | YZQWECMAHIKEMU-OUCADQQQSA-N |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=CC(=O)NC2=O)COC(=O)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)