CAS 96315-06-9 is the registry number for 1,1'-(1,2-Ethanediylbis(oxy))bis(5-methyl-2-nitro-benzene). Offered by: TRC. Available pack sizes: 1g, 2,5g, 500mg.
4-methyl-2-[2-(5-methyl-2-nitrophenoxy)ethoxy]-1-nitrobenzene (CAS 96315-06-9) is a chemical compound with the molecular formula C16H16N2O6 and a molecular weight of 332.31 g/mol. IUPAC name: 4-methyl-2-[2-(5-methyl-2-nitrophenoxy)ethoxy]-1-nitrobenzene. InChIKey: LVSOUJWCHNZHTG-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O6 |
|---|---|
| Molecular weight | 332.31 g/mol |
| IUPAC name | 4-methyl-2-[2-(5-methyl-2-nitrophenoxy)ethoxy]-1-nitrobenzene |
| InChIKey | LVSOUJWCHNZHTG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])OCCOC2=C(C=CC(=C2)C)[N+](=O)[O-] |
Computed by PubChem (NCBI)