CAS 123614-86-8 appears in our catalog under these names: 2-Chloro-4-fluorobenzohydrazide, 95%, 2-Chloro-4-fluorobenzohydrazide, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 25g.
2-chloro-4-fluorobenzohydrazide (CAS 123614-86-8) is a chemical compound with the molecular formula C7H6ClFN2O and a molecular weight of 188.59 g/mol. IUPAC name: 2-chloro-4-fluorobenzohydrazide. InChIKey: FZUCKUWPBURKTN-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFN2O |
|---|---|
| Molecular weight | 188.59 g/mol |
| IUPAC name | 2-chloro-4-fluorobenzohydrazide |
| InChIKey | FZUCKUWPBURKTN-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1F)Cl)C(=O)NN |
Computed by PubChem (NCBI)