CAS 1951444-99-7 is the registry number for 5-Fluoro-1h-indazol-3-ol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
5-fluoro-1,2-dihydroindazol-3-one;hydrochloride (CAS 1951444-99-7) is a chemical compound with the molecular formula C7H6ClFN2O and a molecular weight of 188.59 g/mol. IUPAC name: 5-fluoro-1,2-dihydroindazol-3-one;hydrochloride. InChIKey: AVUAIEULLFFXNK-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFN2O |
|---|---|
| Molecular weight | 188.59 g/mol |
| IUPAC name | 5-fluoro-1,2-dihydroindazol-3-one;hydrochloride |
| InChIKey | AVUAIEULLFFXNK-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1F)C(=O)NN2.Cl |
Computed by PubChem (NCBI)