CAS 1236257-99-0 is the registry number for 2-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-3-(furan-2-yl)propanoic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(furan-2-yl)propanoic acid (CAS 1236257-99-0) is a chemical compound with the molecular formula C22H19NO5 and a molecular weight of 377.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(furan-2-yl)propanoic acid. InChIKey: AJXDCHXGNUFBRC-UHFFFAOYSA-N.
| Molecular formula | C22H19NO5 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(furan-2-yl)propanoic acid |
| InChIKey | AJXDCHXGNUFBRC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CC4=CC=CO4)C(=O)O |
Computed by PubChem (NCBI)