CAS 159611-02-6 appears in our catalog under these names: Fmoc-L-2-furylalanine, >95% (HPLC), (S)–2–((((9H–Fluoren–9–yl)methoxy)carbonyl)amino)–3–(furan–2–yl)propanoic acid, Fmoc-L-Ala(2-Furyl)-OH, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-(2-furyl)-L-alanine, >98.0%(T), Fmoc-3-(2-Furyl)-Ala-OH 97%. Offered by: TRC, GLPBio, Iris Biotech, TCI, Ambeed. Available pack sizes: 1g, 250mg, 5g, 200mg, 100mg, 10g, 25g, 5 g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(furan-2-yl)propanoic acid (CAS 159611-02-6) is a chemical compound with the molecular formula C22H19NO5 and a molecular weight of 377.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(furan-2-yl)propanoic acid. InChIKey: AJXDCHXGNUFBRC-FQEVSTJZSA-N.
| Molecular formula | C22H19NO5 |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-(furan-2-yl)propanoic acid |
| InChIKey | AJXDCHXGNUFBRC-FQEVSTJZSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CC4=CC=CO4)C(=O)O |
Computed by PubChem (NCBI)