CAS 1236357-60-0 appears in our catalog under these names: 1-Bromo-4-(3,3-difluorocyclobutyl)benzene, 98%, 1-Bromo-4-(3,3-difluorocyclobutyl)benzene. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 100mg, 50mg, 250mg, 500mg, 1000mg.
1-bromo-4-(3,3-difluorocyclobutyl)benzene (CAS 1236357-60-0) is a chemical compound with the molecular formula C10H9BrF2 and a molecular weight of 247.08 g/mol. IUPAC name: 1-bromo-4-(3,3-difluorocyclobutyl)benzene. InChIKey: IDBYJNZTYBOAGC-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2 |
|---|---|
| Molecular weight | 247.08 g/mol |
| IUPAC name | 1-bromo-4-(3,3-difluorocyclobutyl)benzene |
| InChIKey | IDBYJNZTYBOAGC-UHFFFAOYSA-N |
| SMILES | C1C(CC1(F)F)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)