Products 1897738-22-5
CAS 1897738-22-5 appears in our catalog under these names: 1-Bromo-3-(3,3-difluorocyclobutyl)benzene, 95%, 1-Bromo-3-(3,3-difluorocyclobutyl)benzene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 0,5g, 50mg.
1-bromo-3-(3,3-difluorocyclobutyl)benzene (CAS 1897738-22-5) is a chemical compound with the molecular formula C10H9BrF2 and a molecular weight of 247.08 g/mol. IUPAC name: 1-bromo-3-(3,3-difluorocyclobutyl)benzene. InChIKey: HJPPMYUYZKVEGP-UHFFFAOYSA-N.
| Molecular formula | C10H9BrF2 |
|---|---|
| Molecular weight | 247.08 g/mol |
| IUPAC name | 1-bromo-3-(3,3-difluorocyclobutyl)benzene |
| InChIKey | HJPPMYUYZKVEGP-UHFFFAOYSA-N |
| SMILES | C1C(CC1(F)F)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)