Products 1236409-39-4
CAS 1236409-39-4 appears in our catalog under these names: 5-Bromo-1,1-dimethyl-1,3-dihydro-2-benzofuran, 5-Bromo-1,1-dimethyl-1,3-dihydroisobenzofuran, 98%, 98%. Offered by: Biosynth, Chemat. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
6-bromo-3,3-dimethyl-1H-2-benzofuran (CAS 1236409-39-4) is a chemical compound with the molecular formula C10H11BrO and a molecular weight of 227.10 g/mol. IUPAC name: 6-bromo-3,3-dimethyl-1H-2-benzofuran. InChIKey: QVNAEBWABGTMPA-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO |
|---|---|
| Molecular weight | 227.10 g/mol |
| IUPAC name | 6-bromo-3,3-dimethyl-1H-2-benzofuran |
| InChIKey | QVNAEBWABGTMPA-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(CO1)C=C(C=C2)Br)C |
Computed by PubChem (NCBI)