Products 1236476-37-1

CAS 1236476-37-1 is the registry number for Methyl 4-bromo-2-methoxy-5-sulfamoylbenzoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 4-bromo-2-methoxy-5-sulfamoylbenzoate (CAS 1236476-37-1) is a chemical compound with the molecular formula C9H10BrNO5S and a molecular weight of 324.15 g/mol. IUPAC name: methyl 4-bromo-2-methoxy-5-sulfamoylbenzoate. InChIKey: YLMYKTNVIPVWKR-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10BrNO5S
Molecular weight324.15 g/mol
IUPAC namemethyl 4-bromo-2-methoxy-5-sulfamoylbenzoate
InChIKeyYLMYKTNVIPVWKR-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1C(=O)OC)S(=O)(=O)N)Br

Computed by PubChem (NCBI)