Products 847758-97-8

CAS 847758-97-8 is the registry number for 2-Bromo-5-(methoxy(methyl)sulfamoyl)benzoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.

Structural formula: {0} (CAS {1})

2-bromo-5-[methoxy(methyl)sulfamoyl]benzoic acid (CAS 847758-97-8) is a chemical compound with the molecular formula C9H10BrNO5S and a molecular weight of 324.15 g/mol. IUPAC name: 2-bromo-5-[methoxy(methyl)sulfamoyl]benzoic acid. InChIKey: YEPNMMVGWMRNLD-UHFFFAOYSA-N.

Identity
Molecular formulaC9H10BrNO5S
Molecular weight324.15 g/mol
IUPAC name2-bromo-5-[methoxy(methyl)sulfamoyl]benzoic acid
InChIKeyYEPNMMVGWMRNLD-UHFFFAOYSA-N
SMILESCN(OC)S(=O)(=O)C1=CC(=C(C=C1)Br)C(=O)O

Computed by PubChem (NCBI)