CAS 1236924-17-6 is the registry number for 7-Chloro-4-(piperazin-1-yl)pyrrolo[1,2-a]quinoxaline, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-4-piperazin-1-ylpyrrolo[1,2-a]quinoxaline (CAS 1236924-17-6) is a chemical compound with the molecular formula C15H15ClN4 and a molecular weight of 286.76 g/mol. IUPAC name: 7-chloro-4-piperazin-1-ylpyrrolo[1,2-a]quinoxaline. InChIKey: FRRPLJALNOTCSV-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN4 |
|---|---|
| Molecular weight | 286.76 g/mol |
| IUPAC name | 7-chloro-4-piperazin-1-ylpyrrolo[1,2-a]quinoxaline |
| InChIKey | FRRPLJALNOTCSV-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC3=C(C=CC(=C3)Cl)N4C2=CC=C4 |
Computed by PubChem (NCBI)