Products 66138-05-4

CAS 66138-05-4 appears in our catalog under these names: 2,3–Diphenyl–5–ethyltetrazolium Chloride, 2,3-Diphenyl-5-ethyltetrazolium Chloride, >98.0%(T), 2,3-Diphenyl-5-ethyltetrazolium Chloride, 98%, 98%, 5-Ethyl-2,3-diphenyl-2H-tetrazol-3-ium chloride, ≥98%. Offered by: GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 10mg.

Structural formula: {0} (CAS {1})

5-ethyl-2,3-diphenyltetrazol-2-ium chloride (CAS 66138-05-4) is a chemical compound with the molecular formula C15H15ClN4 and a molecular weight of 286.76 g/mol. IUPAC name: 5-ethyl-2,3-diphenyltetrazol-2-ium chloride. InChIKey: WDLRRKFNUOOGIW-UHFFFAOYSA-M.

Identity
Molecular formulaC15H15ClN4
Molecular weight286.76 g/mol
IUPAC name5-ethyl-2,3-diphenyltetrazol-2-ium chloride
InChIKeyWDLRRKFNUOOGIW-UHFFFAOYSA-M
SMILESCCC1=NN([N+](=N1)C2=CC=CC=C2)C3=CC=CC=C3.[Cl-]

Computed by PubChem (NCBI)