Products 123788-05-6
CAS 123788-05-6 is the registry number for L-665871. Offered by: MedChemExpress. Available pack sizes: Get quote.
(1R)-1-(6-amino-3-pyridinyl)-2-(tert-butylamino)ethanol (CAS 123788-05-6) is a chemical compound with the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. IUPAC name: (1R)-1-(6-amino-3-pyridinyl)-2-(tert-butylamino)ethanol. InChIKey: HFZJPYRETOGNOT-VIFPVBQESA-N.
| Molecular formula | C11H19N3O |
|---|---|
| Molecular weight | 209.29 g/mol |
| IUPAC name | (1R)-1-(6-amino-3-pyridinyl)-2-(tert-butylamino)ethanol |
| InChIKey | HFZJPYRETOGNOT-VIFPVBQESA-N |
| SMILES | CC(C)(C)NC[C@@H](C1=CN=C(C=C1)N)O |
Computed by PubChem (NCBI)