Products 123811-74-5

CAS 123811-74-5 is the registry number for 4-Methoxypicolinic acid hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 10g, 100g, 5g.

Structural formula: {0} (CAS {1})

4-methoxypyridine-2-carboxylic acid;hydrochloride (CAS 123811-74-5) is a chemical compound with the molecular formula C7H8ClNO3 and a molecular weight of 189.59 g/mol. IUPAC name: 4-methoxypyridine-2-carboxylic acid;hydrochloride. InChIKey: ZQALTXNYLWROAB-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8ClNO3
Molecular weight189.59 g/mol
IUPAC name4-methoxypyridine-2-carboxylic acid;hydrochloride
InChIKeyZQALTXNYLWROAB-UHFFFAOYSA-N
SMILESCOC1=CC(=NC=C1)C(=O)O.Cl

Computed by PubChem (NCBI)