Products 4920-81-4
CAS 4920-81-4 appears in our catalog under these names: 3-Hydroxyanthranilic acid hydrochloride, 98%, 3–Hydroxyanthranilic Acid Hydrochloride, 3-Hydroxyanthranilic acid Hydrochloride, 2-Amino-3-hydroxybenzoic acid hydrochloride. Offered by: Combi-blocks, GLPBio, Biosynth, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 0,25g, 0,5g, 2g, 100mg.
2-amino-3-hydroxybenzoic acid;hydrochloride (CAS 4920-81-4) is a chemical compound with the molecular formula C7H8ClNO3 and a molecular weight of 189.59 g/mol. IUPAC name: 2-amino-3-hydroxybenzoic acid;hydrochloride. InChIKey: WORPVBBWRKRSHQ-UHFFFAOYSA-N.
| Molecular formula | C7H8ClNO3 |
|---|---|
| Molecular weight | 189.59 g/mol |
| IUPAC name | 2-amino-3-hydroxybenzoic acid;hydrochloride |
| InChIKey | WORPVBBWRKRSHQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)O)N)C(=O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
3-Hydroxyanthranilic acid hydrochloride, 2-Amino-3-hydroxybenzoic Acid Hydrochloride, 3-Hydroxyanthranilic acid HCl, 2-amino-3-hydroxybenzoic acid;hydrochloride, WORPVBBWRKRSHQ-UHFFFAOYSA-N, 2-Amino-3-hydroxybenzoicAcidHydrochloride, 2-amino-3-hydroxy-benzoic acid;hydrochloride, 2-Amino-3-hydroxybenzoic acid hydrochloride, AldrichCPR, 2-Amino-3-hydroxybenzoic acid--hydrogen chloride (1/1)