CAS 1238210-14-4 is the registry number for Emtricitabine Impurity 28. Offered by: Chemat Brand. Available pack sizes: on request.
4-amino-5-hydroxy-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one (CAS 1238210-14-4) is a chemical compound with the molecular formula C8H11N3O4S and a molecular weight of 245.26 g/mol. IUPAC name: 4-amino-5-hydroxy-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one. InChIKey: MTEOBIOQZOMCKP-NTSWFWBYSA-N.
| Molecular formula | C8H11N3O4S |
|---|---|
| Molecular weight | 245.26 g/mol |
| IUPAC name | 4-amino-5-hydroxy-1-[(2R,5S)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]pyrimidin-2-one |
| InChIKey | MTEOBIOQZOMCKP-NTSWFWBYSA-N |
| SMILES | C1[C@H](O[C@H](S1)CO)N2C=C(C(=NC2=O)N)O |
Computed by PubChem (NCBI)