Products 123871-68-1
CAS 123871-68-1 is the registry number for 2,4-dichloro-5-nitrophenyl acetate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(2,4-dichloro-5-nitrophenyl) acetate (CAS 123871-68-1) is a chemical compound with the molecular formula C8H5Cl2NO4 and a molecular weight of 250.03 g/mol. IUPAC name: (2,4-dichloro-5-nitrophenyl) acetate. InChIKey: NXTBKIXOTYIPPX-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO4 |
|---|---|
| Molecular weight | 250.03 g/mol |
| IUPAC name | (2,4-dichloro-5-nitrophenyl) acetate |
| InChIKey | NXTBKIXOTYIPPX-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C(=C1)[N+](=O)[O-])Cl)Cl |
Computed by PubChem (NCBI)
Synonyms:
2,4-Dichloro-5-nitrophenyl acetate