Products 34408-25-8
CAS 34408-25-8 appears in our catalog under these names: Methyl 2,5-Dichloro-3-nitrobenzoate, 98%, 98%, Methyl 2,5-dichloro-3-nitrobenzoate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Methyl 2,5-dichloro-3-nitrobenzoate (CAS 34408-25-8) is a chemical compound with the molecular formula C8H5Cl2NO4 and a molecular weight of 250.03 g/mol. IUPAC name: methyl 2,5-dichloro-3-nitrobenzoate. InChIKey: BHIJMLGSGLWEIR-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NO4 |
|---|---|
| Molecular weight | 250.03 g/mol |
| IUPAC name | methyl 2,5-dichloro-3-nitrobenzoate |
| InChIKey | BHIJMLGSGLWEIR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC(=C1)Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)