CAS 1239-94-7 appears in our catalog under these names: Dansyl–L–proline, Dansyl-Pro-OH 97%, (S)-1-((5-(Dimethylamino)Naphthalen-1-Yl)Sulfonyl)Pyrrolidine-2-Carboxylic Acid, 97%, 97%, L-Proline, 1-[[5-(dimethylamino)-1-naphthalenyl]sulfonyl]-, 95%,RG. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 50mg, 5g.
(2S)-1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpyrrolidine-2-carboxylic acid (CAS 1239-94-7) is a chemical compound with the molecular formula C17H20N2O4S and a molecular weight of 348.4 g/mol. IUPAC name: (2S)-1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpyrrolidine-2-carboxylic acid. InChIKey: ZHJIWURDCGMVQE-HNNXBMFYSA-N.
| Molecular formula | C17H20N2O4S |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | (2S)-1-[5-(dimethylamino)naphthalen-1-yl]sulfonylpyrrolidine-2-carboxylic acid |
| InChIKey | ZHJIWURDCGMVQE-HNNXBMFYSA-N |
| SMILES | CN(C)C1=CC=CC2=C1C=CC=C2S(=O)(=O)N3CCC[C@H]3C(=O)O |
Computed by PubChem (NCBI)