CAS 354152-20-8 appears in our catalog under these names: Ac-Met-AMC, Ac–Met–AMC. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: 50mg, 250mg, 100mg.
(2S)-2-acetamido-N-(4-methyl-2-oxochromen-7-yl)-4-methylsulfanylbutanamide (CAS 354152-20-8) is a chemical compound with the molecular formula C17H20N2O4S and a molecular weight of 348.4 g/mol. IUPAC name: (2S)-2-acetamido-N-(4-methyl-2-oxochromen-7-yl)-4-methylsulfanylbutanamide. InChIKey: LCRSOUHHRUJURD-AWEZNQCLSA-N.
| Molecular formula | C17H20N2O4S |
|---|---|
| Molecular weight | 348.4 g/mol |
| IUPAC name | (2S)-2-acetamido-N-(4-methyl-2-oxochromen-7-yl)-4-methylsulfanylbutanamide |
| InChIKey | LCRSOUHHRUJURD-AWEZNQCLSA-N |
| SMILES | CC1=CC(=O)OC2=C1C=CC(=C2)NC(=O)[C@H](CCSC)NC(=O)C |
Computed by PubChem (NCBI)