Products 123926-46-5

CAS 123926-46-5 is the registry number for Terbinafine Impurity 34. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.

Structural formula: {0} (CAS {1})

2-[(E)-6,6-dimethylhept-2-en-4-ynyl]isoindole-1,3-dione (CAS 123926-46-5) is a chemical compound with the molecular formula C17H17NO2 and a molecular weight of 267.32 g/mol. IUPAC name: 2-[(E)-6,6-dimethylhept-2-en-4-ynyl]isoindole-1,3-dione. InChIKey: JEEXGKOOKVCNOH-XBXARRHUSA-N.

Identity
Molecular formulaC17H17NO2
Molecular weight267.32 g/mol
IUPAC name2-[(E)-6,6-dimethylhept-2-en-4-ynyl]isoindole-1,3-dione
InChIKeyJEEXGKOOKVCNOH-XBXARRHUSA-N
SMILESCC(C)(C)C#C/C=C/CN1C(=O)C2=CC=CC=C2C1=O

Computed by PubChem (NCBI)