Products 1239320-12-7
CAS 1239320-12-7 is the registry number for tert-Butyl 6-azido-2-azaspiro[3.3]heptane-2-carboxylate, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl 6-azido-2-azaspiro[3.3]heptane-2-carboxylate (CAS 1239320-12-7) is a chemical compound with the molecular formula C11H18N4O2 and a molecular weight of 238.29 g/mol. IUPAC name: tert-butyl 6-azido-2-azaspiro[3.3]heptane-2-carboxylate. InChIKey: WDVNJMUEFDQTOW-UHFFFAOYSA-N.
| Molecular formula | C11H18N4O2 |
|---|---|
| Molecular weight | 238.29 g/mol |
| IUPAC name | tert-butyl 6-azido-2-azaspiro[3.3]heptane-2-carboxylate |
| InChIKey | WDVNJMUEFDQTOW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CC(C2)N=[N+]=[N-] |
Computed by PubChem (NCBI)