Products 1239479-56-1
CAS 1239479-56-1 is the registry number for 3,5-Dimethyl-1H-pyrazole-4-sulfonyl chloride hydrochloride, 97%. Offered by: Fluorochem. Available pack sizes: 1g.
3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride;hydrochloride (CAS 1239479-56-1) is a chemical compound with the molecular formula C5H8Cl2N2O2S and a molecular weight of 231.10 g/mol. IUPAC name: 3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride;hydrochloride. InChIKey: YGJFLKJSDBKCER-UHFFFAOYSA-N.
| Molecular formula | C5H8Cl2N2O2S |
|---|---|
| Molecular weight | 231.10 g/mol |
| IUPAC name | 3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride;hydrochloride |
| InChIKey | YGJFLKJSDBKCER-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NN1)C)S(=O)(=O)Cl.Cl |
Computed by PubChem (NCBI)