CAS 1239703-27-5 is the registry number for 4-(4-Chlorobenzyl)-1,2-dimethoxybenzene, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[(4-chlorophenyl)methyl]-1,2-dimethoxybenzene (CAS 1239703-27-5) is a chemical compound with the molecular formula C15H15ClO2 and a molecular weight of 262.73 g/mol. IUPAC name: 4-[(4-chlorophenyl)methyl]-1,2-dimethoxybenzene. InChIKey: LNLPVSFQZXAWEH-UHFFFAOYSA-N.
| Molecular formula | C15H15ClO2 |
|---|---|
| Molecular weight | 262.73 g/mol |
| IUPAC name | 4-[(4-chlorophenyl)methyl]-1,2-dimethoxybenzene |
| InChIKey | LNLPVSFQZXAWEH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CC2=CC=C(C=C2)Cl)OC |
Computed by PubChem (NCBI)