CAS 7525-23-7 appears in our catalog under these names: 4,4'-(Chloromethylene)bis(methoxybenzene), 96%, 96%, BIS(4-METHOXYPHENYL)METHYL CHLORIDE, 96%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-[chloro-(4-methoxyphenyl)methyl]-4-methoxybenzene (CAS 7525-23-7) is a chemical compound with the molecular formula C15H15ClO2 and a molecular weight of 262.73 g/mol. IUPAC name: 1-[chloro-(4-methoxyphenyl)methyl]-4-methoxybenzene. InChIKey: YXOMWGPGGXZCKU-UHFFFAOYSA-N.
| Molecular formula | C15H15ClO2 |
|---|---|
| Molecular weight | 262.73 g/mol |
| IUPAC name | 1-[chloro-(4-methoxyphenyl)methyl]-4-methoxybenzene |
| InChIKey | YXOMWGPGGXZCKU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C(C2=CC=C(C=C2)OC)Cl |
Computed by PubChem (NCBI)