CAS 1239785-99-9 is the registry number for [1-(3-Phenyl-1,2,4-oxadiazol-5-yl)cyclohexyl]amine hydrochloride, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(3-phenyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine;hydrochloride (CAS 1239785-99-9) is a chemical compound with the molecular formula C14H18ClN3O and a molecular weight of 279.76 g/mol. IUPAC name: 1-(3-phenyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine;hydrochloride. InChIKey: TWCLRVSJTRABRG-UHFFFAOYSA-N.
| Molecular formula | C14H18ClN3O |
|---|---|
| Molecular weight | 279.76 g/mol |
| IUPAC name | 1-(3-phenyl-1,2,4-oxadiazol-5-yl)cyclohexan-1-amine;hydrochloride |
| InChIKey | TWCLRVSJTRABRG-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)(C2=NC(=NO2)C3=CC=CC=C3)N.Cl |
Computed by PubChem (NCBI)